C17H13N9O — CID 169346802
3-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346802) has the molecular formula C17H13N9O and a molecular weight of 359.35 g/mol. Its IUPAC name is 3-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346802 |
| Molecular Formula | C17H13N9O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methoxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | COc1ccc(-c2cn3cccnc3n2)cc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C17H13N9O/c1-27-15-4-3-11(14-10-26-6-2-5-19-17(26)21-14)7-13(15)20-9-12(8-18)16-22-24-25-23-16/h2-7,9-10,20H,1H3,(H,22,23,24,25) |
| InChIKey | LAXWPLAAXHOLAO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|