C14H10N4O2 — CID 168610054
2-[2-methyl-4-(1,2,2-tricyanoethenylamino)phenyl]acetic acid (PubChem CID 168610054) has the molecular formula C14H10N4O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-[2-methyl-4-(1,2,2-tricyanoethenylamino)phenyl]acetic acid.
| Compound Name | 2-[2-methyl-4-(1,2,2-tricyanoethenylamino)phenyl]acetic acid |
|---|---|
| PubChem CID | 168610054 |
| Molecular Formula | C14H10N4O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-[2-methyl-4-(1,2,2-tricyanoethenylamino)phenyl]acetic acid |
| SMILES | Cc1cc(NC(C#N)=C(C#N)C#N)ccc1CC(=O)O |
| InChI | InChI=1S/C14H10N4O2/c1-9-4-12(3-2-10(9)5-14(19)20)18-13(8-17)11(6-15)7-16/h2-4,18H,5H2,1H3,(H,19,20) |
| InChIKey | UYYJURFZZVPIBF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|