C16H11N5O — CID 168608762
2-[(1,3-dimethyl-2-oxoquinolin-6-yl)amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608762) has the molecular formula C16H11N5O and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2-oxoquinolin-6-yl)amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[(1,3-dimethyl-2-oxoquinolin-6-yl)amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608762 |
| Molecular Formula | C16H11N5O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[(1,3-dimethyl-2-oxoquinolin-6-yl)amino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1cc2cc(NC(C#N)=C(C#N)C#N)ccc2n(C)c1=O |
| InChI | InChI=1S/C16H11N5O/c1-10-5-11-6-13(3-4-15(11)21(2)16(10)22)20-14(9-19)12(7-17)8-18/h3-6,20H,1-2H3 |
| InChIKey | QZPHMUUZKBJPTH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|