C21H21N3OS — CID 176970108
4-[(1,3-dimethyl-2-oxoquinolin-6-yl)amino]sulfanyl-3-propan-2-ylbenzonitrile (PubChem CID 176970108) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 4-[(1,3-dimethyl-2-oxoquinolin-6-yl)amino]sulfanyl-3-propan-2-ylbenzonitrile.
| Compound Name | 4-[(1,3-dimethyl-2-oxoquinolin-6-yl)amino]sulfanyl-3-propan-2-ylbenzonitrile |
|---|---|
| PubChem CID | 176970108 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[(1,3-dimethyl-2-oxoquinolin-6-yl)amino]sulfanyl-3-propan-2-ylbenzonitrile |
| SMILES | Cc1cc2cc(NSc3ccc(C#N)cc3C(C)C)ccc2n(C)c1=O |
| InChI | InChI=1S/C21H21N3OS/c1-13(2)18-10-15(12-22)5-8-20(18)26-23-17-6-7-19-16(11-17)9-14(3)21(25)24(19)4/h5-11,13,23H,1-4H3 |
| InChIKey | PEBQPJXDVYLKJD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|