C19H16FN3O2S — CID 145026852
4-[(8-fluoro-1,3-dimethyl-2-oxoquinolin-6-yl)amino]sulfanyl-3-methoxybenzonitrile (PubChem CID 145026852) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-[(8-fluoro-1,3-dimethyl-2-oxoquinolin-6-yl)amino]sulfanyl-3-methoxybenzonitrile.
| Compound Name | 4-[(8-fluoro-1,3-dimethyl-2-oxoquinolin-6-yl)amino]sulfanyl-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 145026852 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-[(8-fluoro-1,3-dimethyl-2-oxoquinolin-6-yl)amino]sulfanyl-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1SNc1cc(F)c2c(c1)cc(C)c(=O)n2C |
| InChI | InChI=1S/C19H16FN3O2S/c1-11-6-13-8-14(9-15(20)18(13)23(2)19(11)24)22-26-17-5-4-12(10-21)7-16(17)25-3/h4-9,22H,1-3H3 |
| InChIKey | WIDMUGNQYGVAMM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|