C12H11FN2OS — CID 71999552
3-fluoro-4-(1-methyl-2-oxopyrrolidin-3-yl)sulfanylbenzonitrile (PubChem CID 71999552) has the molecular formula C12H11FN2OS and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-fluoro-4-(1-methyl-2-oxopyrrolidin-3-yl)sulfanylbenzonitrile.
| Compound Name | 3-fluoro-4-(1-methyl-2-oxopyrrolidin-3-yl)sulfanylbenzonitrile |
|---|---|
| PubChem CID | 71999552 |
| Molecular Formula | C12H11FN2OS |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-fluoro-4-(1-methyl-2-oxopyrrolidin-3-yl)sulfanylbenzonitrile |
| SMILES | CN1CCC(Sc2ccc(C#N)cc2F)C1=O |
| InChI | InChI=1S/C12H11FN2OS/c1-15-5-4-11(12(15)16)17-10-3-2-8(7-14)6-9(10)13/h2-3,6,11H,4-5H2,1H3 |
| InChIKey | UMBRAEPDNWKMRF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |