C15H12N4OS — CID 124624544
4-[(3S)-2-oxo-3-pyrimidin-2-ylsulfanylpyrrolidin-1-yl]benzonitrile (PubChem CID 124624544) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is 4-[(3S)-2-oxo-3-pyrimidin-2-ylsulfanylpyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3S)-2-oxo-3-pyrimidin-2-ylsulfanylpyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 124624544 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-[(3S)-2-oxo-3-pyrimidin-2-ylsulfanylpyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CC[C@H](Sc3ncccn3)C2=O)cc1 |
| InChI | InChI=1S/C15H12N4OS/c16-10-11-2-4-12(5-3-11)19-9-6-13(14(19)20)21-15-17-7-1-8-18-15/h1-5,7-8,13H,6,9H2/t13-/m0/s1 |
| InChIKey | QYRDMPYPNCAJQZ-ZDUSSCGKSA-N |
| XLogP | 2.25 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |