C16H11F2NO3S — CID 22830348
(4-cyano-2-methoxyphenyl) 2-(3,4-difluorophenyl)sulfanylacetate (PubChem CID 22830348) has the molecular formula C16H11F2NO3S and a molecular weight of 335.33 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 2-(3,4-difluorophenyl)sulfanylacetate.
| Compound Name | (4-cyano-2-methoxyphenyl) 2-(3,4-difluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 22830348 |
| Molecular Formula | C16H11F2NO3S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 2-(3,4-difluorophenyl)sulfanylacetate |
| SMILES | COc1cc(C#N)ccc1OC(=O)CSc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H11F2NO3S/c1-21-15-6-10(8-19)2-5-14(15)22-16(20)9-23-11-3-4-12(17)13(18)7-11/h2-7H,9H2,1H3 |
| InChIKey | NHPMDDTUKBHQQG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|