C24H17FN4O3S — CID 42999752
(4-cyano-2-methoxyphenyl) 2-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 42999752) has the molecular formula C24H17FN4O3S and a molecular weight of 460.49 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 2-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | (4-cyano-2-methoxyphenyl) 2-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 42999752 |
| Molecular Formula | C24H17FN4O3S |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 2-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | COc1cc(C#N)ccc1OC(=O)CSc1nnc(-c2ccc(F)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C24H17FN4O3S/c1-31-21-13-16(14-26)7-12-20(21)32-22(30)15-33-24-28-27-23(17-8-10-18(25)11-9-17)29(24)19-5-3-2-4-6-19/h2-13H,15H2,1H3 |
| InChIKey | GUUZABGICOZOKZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|