C18H15N3O3S — CID 118933132
4-cyano-N-(1,3-dimethyl-2-oxoquinolin-6-yl)benzenesulfonamide (PubChem CID 118933132) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 4-cyano-N-(1,3-dimethyl-2-oxoquinolin-6-yl)benzenesulfonamide.
| Compound Name | 4-cyano-N-(1,3-dimethyl-2-oxoquinolin-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118933132 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 4-cyano-N-(1,3-dimethyl-2-oxoquinolin-6-yl)benzenesulfonamide |
| SMILES | Cc1cc2cc(NS(=O)(=O)c3ccc(C#N)cc3)ccc2n(C)c1=O |
| InChI | InChI=1S/C18H15N3O3S/c1-12-9-14-10-15(5-8-17(14)21(2)18(12)22)20-25(23,24)16-6-3-13(11-19)4-7-16/h3-10,20H,1-2H3 |
| InChIKey | BMVCSXFOQPYKKC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |