C25H23N5O3S — CID 50825278
4-[5-[(4-cyanophenyl)sulfonylamino]-1-methylbenzimidazol-2-yl]-N-propan-2-ylbenzamide (PubChem CID 50825278) has the molecular formula C25H23N5O3S and a molecular weight of 473.56 g/mol. Its IUPAC name is 4-[5-[(4-cyanophenyl)sulfonylamino]-1-methylbenzimidazol-2-yl]-N-propan-2-ylbenzamide.
| Compound Name | 4-[5-[(4-cyanophenyl)sulfonylamino]-1-methylbenzimidazol-2-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 50825278 |
| Molecular Formula | C25H23N5O3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 4-[5-[(4-cyanophenyl)sulfonylamino]-1-methylbenzimidazol-2-yl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(-c2nc3cc(NS(=O)(=O)c4ccc(C#N)cc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C25H23N5O3S/c1-16(2)27-25(31)19-8-6-18(7-9-19)24-28-22-14-20(10-13-23(22)30(24)3)29-34(32,33)21-11-4-17(15-26)5-12-21/h4-14,16,29H,1-3H3,(H,27,31) |
| InChIKey | RITGOSCSUDBNIS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |