C13H6F2N4O2 — CID 168608938
2-[2,3-difluoro-4-(1,2,2-tricyanoethenylamino)phenyl]acetic acid (PubChem CID 168608938) has the molecular formula C13H6F2N4O2 and a molecular weight of 288.21 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(1,2,2-tricyanoethenylamino)phenyl]acetic acid.
| Compound Name | 2-[2,3-difluoro-4-(1,2,2-tricyanoethenylamino)phenyl]acetic acid |
|---|---|
| PubChem CID | 168608938 |
| Molecular Formula | C13H6F2N4O2 |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-[2,3-difluoro-4-(1,2,2-tricyanoethenylamino)phenyl]acetic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(CC(=O)O)c(F)c1F |
| InChI | InChI=1S/C13H6F2N4O2/c14-12-7(3-11(20)21)1-2-9(13(12)15)19-10(6-18)8(4-16)5-17/h1-2,19H,3H2,(H,20,21) |
| InChIKey | NTDNIIQVKAFXSR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|