C14H8F2N4O2 — CID 168609742
methyl 2-[2,3-difluoro-4-(1,2,2-tricyanoethenylamino)phenyl]acetate (PubChem CID 168609742) has the molecular formula C14H8F2N4O2 and a molecular weight of 302.24 g/mol. Its IUPAC name is methyl 2-[2,3-difluoro-4-(1,2,2-tricyanoethenylamino)phenyl]acetate.
| Compound Name | methyl 2-[2,3-difluoro-4-(1,2,2-tricyanoethenylamino)phenyl]acetate |
|---|---|
| PubChem CID | 168609742 |
| Molecular Formula | C14H8F2N4O2 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | methyl 2-[2,3-difluoro-4-(1,2,2-tricyanoethenylamino)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(NC(C#N)=C(C#N)C#N)c(F)c1F |
| InChI | InChI=1S/C14H8F2N4O2/c1-22-12(21)4-8-2-3-10(14(16)13(8)15)20-11(7-19)9(5-17)6-18/h2-3,20H,4H2,1H3 |
| InChIKey | YGOSJMNYVSMPFM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|