C11H4FIN4O — CID 168610310
2-(3-fluoro-2-hydroxy-4-iodoanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168610310) has the molecular formula C11H4FIN4O and a molecular weight of 354.08 g/mol. Its IUPAC name is 2-(3-fluoro-2-hydroxy-4-iodoanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(3-fluoro-2-hydroxy-4-iodoanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610310 |
| Molecular Formula | C11H4FIN4O |
| Molecular Weight | 354.08 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 2-(3-fluoro-2-hydroxy-4-iodoanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(I)c(F)c1O |
| InChI | InChI=1S/C11H4FIN4O/c12-10-7(13)1-2-8(11(10)18)17-9(5-16)6(3-14)4-15/h1-2,17-18H |
| InChIKey | FBXXGKFUQMPNTI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.08 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|