About pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate
pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate (PubChem CID 20716333) has the molecular formula C16H16N2O4
and a molecular weight of 300.31 g/mol. Its IUPAC name is pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate.
Molecular Properties
| Compound Name | pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate |
| PubChem CID | 20716333 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate |
| SMILES | COc1cc(C(C)=O)ccc1NC(=O)OCc1ccncc1 |
| InChI | InChI=1S/C16H16N2O4/c1-11(19)13-3-4-14(15(9-13)21-2)18-16(20)22-10-12-5-7-17-8-6-12/h3-9H,10H2,1-2H3,(H,18,20) |
| InChIKey | ZBDUJTPTDFLNRQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate?
The IUPAC name of pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate (CID 20716333) is pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate.
What is the SMILES notation for pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate?
The canonical SMILES for pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate is COc1cc(C(C)=O)ccc1NC(=O)OCc1ccncc1.
What is the InChIKey of pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate?
The InChIKey is ZBDUJTPTDFLNRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4/c1-11(19)13-3-4-14(15(9-13)21-2)18-16(20)22-10-12-5-7-17-8-6-12/h3-9H,10H2,1-2H3,(H,18,20).
What are the key properties of pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate?
pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate has a molecular weight of 300.31 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-ylmethyl N-(4-acetyl-2-methoxyphenyl)carbamate is sourced from PubChem (CID 20716333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).