C37H44N8O6 — CID 58321345
3-[[3-(4-anilino-3-nitroanilino)-3-oxopropyl]-[3-(diethylamino)propyl]amino]-N-(4-anilino-3-nitrophenyl)propanamide (PubChem CID 58321345) has the molecular formula C37H44N8O6 and a molecular weight of 696.81 g/mol. Its IUPAC name is 3-[[3-(4-anilino-3-nitroanilino)-3-oxopropyl]-[3-(diethylamino)propyl]amino]-N-(4-anilino-3-nitrophenyl)propanamide.
| Compound Name | 3-[[3-(4-anilino-3-nitroanilino)-3-oxopropyl]-[3-(diethylamino)propyl]amino]-N-(4-anilino-3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 58321345 |
| Molecular Formula | C37H44N8O6 |
| Molecular Weight | 696.81 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | 3-[[3-(4-anilino-3-nitroanilino)-3-oxopropyl]-[3-(diethylamino)propyl]amino]-N-(4-anilino-3-nitrophenyl)propanamide |
| SMILES | CCN(CC)CCCN(CCC(=O)Nc1ccc(Nc2ccccc2)c([N+](=O)[O-])c1)CCC(=O)Nc1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H44N8O6/c1-3-42(4-2)22-11-23-43(24-20-36(46)40-30-16-18-32(34(26-30)44(48)49)38-28-12-7-5-8-13-28)25-21-37(47)41-31-17-19-33(35(27-31)45(50)51)39-29-14-9-6-10-15-29/h5-10,12-19,26-27,38-39H,3-4,11,20-25H2,1-2H3,(H,40,46)(H,41,47) |
| InChIKey | GRNALKTXBFSNBJ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 175.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.81 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|