C19H20N2O4 — CID 108796232
N-(4-ethyl-3-nitrophenyl)-5-oxo-5-phenylpentanamide (PubChem CID 108796232) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-(4-ethyl-3-nitrophenyl)-5-oxo-5-phenylpentanamide.
| Compound Name | N-(4-ethyl-3-nitrophenyl)-5-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 108796232 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(4-ethyl-3-nitrophenyl)-5-oxo-5-phenylpentanamide |
| SMILES | CCc1ccc(NC(=O)CCCC(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N2O4/c1-2-14-11-12-16(13-17(14)21(24)25)20-19(23)10-6-9-18(22)15-7-4-3-5-8-15/h3-5,7-8,11-13H,2,6,9-10H2,1H3,(H,20,23) |
| InChIKey | CMNPFRKGMNQJST-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|