C12H6BrN5O2 — CID 168606849
2-(4-bromo-2-methyl-5-nitroanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168606849) has the molecular formula C12H6BrN5O2 and a molecular weight of 332.12 g/mol. Its IUPAC name is 2-(4-bromo-2-methyl-5-nitroanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(4-bromo-2-methyl-5-nitroanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168606849 |
| Molecular Formula | C12H6BrN5O2 |
| Molecular Weight | 332.12 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 2-(4-bromo-2-methyl-5-nitroanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1cc(Br)c([N+](=O)[O-])cc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C12H6BrN5O2/c1-7-2-9(13)12(18(19)20)3-10(7)17-11(6-16)8(4-14)5-15/h2-3,17H,1H3 |
| InChIKey | PYMQVLQWUREOSC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.12 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|