C10H15N3O4 — CID 80842073
2-[3-(methylamino)-2-nitroanilino]propane-1,3-diol (PubChem CID 80842073) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[3-(methylamino)-2-nitroanilino]propane-1,3-diol.
| Compound Name | 2-[3-(methylamino)-2-nitroanilino]propane-1,3-diol |
|---|---|
| PubChem CID | 80842073 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-[3-(methylamino)-2-nitroanilino]propane-1,3-diol |
| SMILES | CNc1cccc(NC(CO)CO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O4/c1-11-8-3-2-4-9(10(8)13(16)17)12-7(5-14)6-15/h2-4,7,11-12,14-15H,5-6H2,1H3 |
| InChIKey | SHHAPHGHCQQHSA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|