C14H23N3O2 — CID 80839098
1-N-methyl-3-N-(5-methylhexan-2-yl)-2-nitrobenzene-1,3-diamine (PubChem CID 80839098) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-N-methyl-3-N-(5-methylhexan-2-yl)-2-nitrobenzene-1,3-diamine.
| Compound Name | 1-N-methyl-3-N-(5-methylhexan-2-yl)-2-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 80839098 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-N-methyl-3-N-(5-methylhexan-2-yl)-2-nitrobenzene-1,3-diamine |
| SMILES | CNc1cccc(NC(C)CCC(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H23N3O2/c1-10(2)8-9-11(3)16-13-7-5-6-12(15-4)14(13)17(18)19/h5-7,10-11,15-16H,8-9H2,1-4H3 |
| InChIKey | ZPSGLJYALJYVKP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|