C70H67ClN2S — CID 177085329
3-N-(5-tert-butyl-1-benzothiophen-3-yl)-1-N,3-N-bis(4-tert-butylphenyl)-1-N-(4-tert-butyl-2-pyren-1-ylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine (PubChem CID 177085329) has the molecular formula C70H67ClN2S and a molecular weight of 1003.84 g/mol. Its IUPAC name is 3-N-(5-tert-butyl-1-benzothiophen-3-yl)-1-N,3-N-bis(4-tert-butylphenyl)-1-N-(4-tert-butyl-2-pyren-1-ylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine.
| Compound Name | 3-N-(5-tert-butyl-1-benzothiophen-3-yl)-1-N,3-N-bis(4-tert-butylphenyl)-1-N-(4-tert-butyl-2-pyren-1-ylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 177085329 |
| Molecular Formula | C70H67ClN2S |
| Molecular Weight | 1003.84 g/mol |
| Exact Mass | 1002.47 |
| IUPAC Name | 3-N-(5-tert-butyl-1-benzothiophen-3-yl)-1-N,3-N-bis(4-tert-butylphenyl)-1-N-(4-tert-butyl-2-pyren-1-ylphenyl)-2-chloro-5-phenylbenzene-1,3-diamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2-c2ccc3ccc4cccc5ccc2c3c45)c2cc(-c3ccccc3)cc(N(c3ccc(C(C)(C)C)cc3)c3csc4ccc(C(C)(C)C)cc34)c2Cl)cc1 |
| InChI | InChI=1S/C70H67ClN2S/c1-67(2,3)49-25-31-53(32-26-49)72(59-37-29-51(69(7,8)9)41-57(59)55-35-23-47-22-21-45-19-16-20-46-24-36-56(55)65(47)64(45)46)60-39-48(44-17-14-13-15-18-44)40-61(66(60)71)73(54-33-27-50(28-34-54)68(4,5)6)62-43-74-63-38-30-52(42-58(62)63)70(10,11)12/h13-43H,1-12H3 |
| InChIKey | KTQFIUCJLJZWSJ-UHFFFAOYSA-N |
| XLogP | 21.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.84 |
| LogP ≤ 5 | 21.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|