C44H32BrCl2N — CID 177085454
3-bromo-N-(4-tert-butyl-2-pyren-2-ylphenyl)-2,5-dichloro-N-(4-phenylphenyl)aniline (PubChem CID 177085454) has the molecular formula C44H32BrCl2N and a molecular weight of 725.56 g/mol. Its IUPAC name is 3-bromo-N-(4-tert-butyl-2-pyren-2-ylphenyl)-2,5-dichloro-N-(4-phenylphenyl)aniline.
| Compound Name | 3-bromo-N-(4-tert-butyl-2-pyren-2-ylphenyl)-2,5-dichloro-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 177085454 |
| Molecular Formula | C44H32BrCl2N |
| Molecular Weight | 725.56 g/mol |
| Exact Mass | 723.11 |
| IUPAC Name | 3-bromo-N-(4-tert-butyl-2-pyren-2-ylphenyl)-2,5-dichloro-N-(4-phenylphenyl)aniline |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2cc(Cl)cc(Br)c2Cl)c(-c2cc3ccc4cccc5ccc(c2)c3c45)c1 |
| InChI | InChI=1S/C44H32BrCl2N/c1-44(2,3)34-18-21-39(37(24-34)33-22-31-14-12-29-10-7-11-30-13-15-32(23-33)42(31)41(29)30)48(40-26-35(46)25-38(45)43(40)47)36-19-16-28(17-20-36)27-8-5-4-6-9-27/h4-26H,1-3H3 |
| InChIKey | GMKLVUAERNYYKF-UHFFFAOYSA-N |
| XLogP | 14.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.56 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|