C47H46N2 — CID 155655785
N-[4-[4-[2,2-bis(4-tert-butylphenyl)-1-isocyanoethyl]phenyl]phenyl]-4-phenylaniline (PubChem CID 155655785) has the molecular formula C47H46N2 and a molecular weight of 638.90 g/mol. Its IUPAC name is N-[4-[4-[2,2-bis(4-tert-butylphenyl)-1-isocyanoethyl]phenyl]phenyl]-4-phenylaniline.
| Compound Name | N-[4-[4-[2,2-bis(4-tert-butylphenyl)-1-isocyanoethyl]phenyl]phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 155655785 |
| Molecular Formula | C47H46N2 |
| Molecular Weight | 638.90 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | N-[4-[4-[2,2-bis(4-tert-butylphenyl)-1-isocyanoethyl]phenyl]phenyl]-4-phenylaniline |
| SMILES | [C-]#[N+]C(c1ccc(-c2ccc(Nc3ccc(-c4ccccc4)cc3)cc2)cc1)C(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C47H46N2/c1-46(2,3)40-25-17-37(18-26-40)44(38-19-27-41(28-20-38)47(4,5)6)45(48-7)39-15-13-34(14-16-39)36-23-31-43(32-24-36)49-42-29-21-35(22-30-42)33-11-9-8-10-12-33/h8-32,44-45,49H,1-6H3 |
| InChIKey | SMCRBBKHPCXQGF-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 16.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.90 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|