C36H25NO — CID 129086279
4-(3-dibenzofuran-2-ylphenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline (PubChem CID 129086279) has the molecular formula C36H25NO and a molecular weight of 492.63 g/mol. Its IUPAC name is 4-(3-dibenzofuran-2-ylphenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline.
| Compound Name | 4-(3-dibenzofuran-2-ylphenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 129086279 |
| Molecular Formula | C36H25NO |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-(3-dibenzofuran-2-ylphenyl)-N-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(Nc3ccc(-c4cccc(-c5ccc6oc7ccccc7c6c5)c4)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C36H25NO/c1-2-7-25(8-3-1)26-13-18-31(19-14-26)37-32-20-15-27(16-21-32)28-9-6-10-29(23-28)30-17-22-36-34(24-30)33-11-4-5-12-35(33)38-36/h1-24,37H/i1D,2D,3D,7D,8D |
| InChIKey | YGGAOVGVSSDABN-RCQSQLKUSA-N |
| XLogP | 10.33 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |