C64H56Ge — CID 176639443
[4-[2,6-ditert-butyl-10-[3,4,5-trideuterio-2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]phenyl]-triphenylgermane (PubChem CID 176639443) has the molecular formula C64H56Ge and a molecular weight of 910.84 g/mol. Its IUPAC name is [4-[2,6-ditert-butyl-10-[3,4,5-trideuterio-2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]phenyl]-triphenylgermane.
| Compound Name | [4-[2,6-ditert-butyl-10-[3,4,5-trideuterio-2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]phenyl]-triphenylgermane |
|---|---|
| PubChem CID | 176639443 |
| Molecular Formula | C64H56Ge |
| Molecular Weight | 910.84 g/mol |
| Exact Mass | 911.44 |
| IUPAC Name | [4-[2,6-ditert-butyl-10-[3,4,5-trideuterio-2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]phenyl]-triphenylgermane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-c2c3ccc(C(C)(C)C)cc3c(-c3ccc([Ge](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c3ccc(C(C)(C)C)cc23)c([2H])c1[2H] |
| InChI | InChI=1S/C64H56Ge/c1-63(2,3)48-38-42-57-58(43-48)60(47-35-39-53(40-36-47)65(50-27-16-9-17-28-50,51-29-18-10-19-30-51)52-31-20-11-21-32-52)56-41-37-49(64(4,5)6)44-59(56)62(57)61-54(45-23-12-7-13-24-45)33-22-34-55(61)46-25-14-8-15-26-46/h7-44H,1-6H3/i7D,8D,12D,13D,14D,15D,22D,23D,24D,25D,26D,33D,34D |
| InChIKey | SMBJPSLTJBJKHV-XJHBPAOGSA-N |
| XLogP | 14.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.84 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|