C49H45N3 — CID 141226985
2,4-bis(5-tert-butyl-2-phenylphenyl)-6-(5-ethenyl-2-phenylphenyl)-1,3,5-triazine (PubChem CID 141226985) has the molecular formula C49H45N3 and a molecular weight of 675.92 g/mol. Its IUPAC name is 2,4-bis(5-tert-butyl-2-phenylphenyl)-6-(5-ethenyl-2-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis(5-tert-butyl-2-phenylphenyl)-6-(5-ethenyl-2-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 141226985 |
| Molecular Formula | C49H45N3 |
| Molecular Weight | 675.92 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | 2,4-bis(5-tert-butyl-2-phenylphenyl)-6-(5-ethenyl-2-phenylphenyl)-1,3,5-triazine |
| SMILES | C=Cc1ccc(-c2ccccc2)c(-c2nc(-c3cc(C(C)(C)C)ccc3-c3ccccc3)nc(-c3cc(C(C)(C)C)ccc3-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C49H45N3/c1-8-33-24-27-39(34-18-12-9-13-19-34)42(30-33)45-50-46(43-31-37(48(2,3)4)25-28-40(43)35-20-14-10-15-21-35)52-47(51-45)44-32-38(49(5,6)7)26-29-41(44)36-22-16-11-17-23-36/h8-32H,1H2,2-7H3 |
| InChIKey | DBMUUWOIKNFXRE-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.92 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |