C58H48N2 — CID 170900903
9,23-bis(4-tert-butyl-2-phenylphenyl)-14,28-diazaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaene (PubChem CID 170900903) has the molecular formula C58H48N2 and a molecular weight of 773.04 g/mol. Its IUPAC name is 9,23-bis(4-tert-butyl-2-phenylphenyl)-14,28-diazaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaene.
| Compound Name | 9,23-bis(4-tert-butyl-2-phenylphenyl)-14,28-diazaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaene |
|---|---|
| PubChem CID | 170900903 |
| Molecular Formula | C58H48N2 |
| Molecular Weight | 773.04 g/mol |
| Exact Mass | 772.38 |
| IUPAC Name | 9,23-bis(4-tert-butyl-2-phenylphenyl)-14,28-diazaheptacyclo[15.11.0.03,15.04,13.06,11.018,27.020,25]octacosa-1(17),2,4(13),5,7,9,11,15,18(27),19,21,23,25-tridecaene |
| SMILES | CC(C)(C)c1ccc(-c2ccc3cc4c(cc3c2)[nH]c2cc3c(cc24)[nH]c2cc4cc(-c5ccc(C(C)(C)C)cc5-c5ccccc5)ccc4cc23)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C58H48N2/c1-57(2,3)43-21-23-45(47(31-43)35-13-9-7-10-14-35)39-19-17-37-27-49-51-33-56-52(34-55(51)59-53(49)29-41(37)25-39)50-28-38-18-20-40(26-42(38)30-54(50)60-56)46-24-22-44(58(4,5)6)32-48(46)36-15-11-8-12-16-36/h7-34,59-60H,1-6H3 |
| InChIKey | AZGBZDXSHZXOSQ-UHFFFAOYSA-N |
| XLogP | 16.52 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.04 |
| LogP ≤ 5 | 16.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |