C21H25NO3 — CID 171884083
N-[4-(9,9-dimethylfluoren-2-yl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171884083) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[4-(9,9-dimethylfluoren-2-yl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(9,9-dimethylfluoren-2-yl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171884083 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[4-(9,9-dimethylfluoren-2-yl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C21H25NO3/c1-13(23)22-11-10-19(24)20(25)14-8-9-16-15-6-4-5-7-17(15)21(2,3)18(16)12-14/h4-9,12,19-20,24-25H,10-11H2,1-3H3,(H,22,23) |
| InChIKey | QZQLOTMSHMIASG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |