C20H25NO2 — CID 171891251
1-(9,9-dimethylfluoren-2-yl)-4-(methylamino)butane-1,2-diol (PubChem CID 171891251) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(9,9-dimethylfluoren-2-yl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(9,9-dimethylfluoren-2-yl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171891251 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-(9,9-dimethylfluoren-2-yl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C20H25NO2/c1-20(2)16-7-5-4-6-14(16)15-9-8-13(12-17(15)20)19(23)18(22)10-11-21-3/h4-9,12,18-19,21-23H,10-11H2,1-3H3 |
| InChIKey | FHDHJOCTKZDYMD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |