C14H25NO2Si — CID 171890466
4-(methylamino)-1-(3-trimethylsilylphenyl)butane-1,2-diol (PubChem CID 171890466) has the molecular formula C14H25NO2Si and a molecular weight of 267.44 g/mol. Its IUPAC name is 4-(methylamino)-1-(3-trimethylsilylphenyl)butane-1,2-diol.
| Compound Name | 4-(methylamino)-1-(3-trimethylsilylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171890466 |
| Molecular Formula | C14H25NO2Si |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-(methylamino)-1-(3-trimethylsilylphenyl)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cccc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C14H25NO2Si/c1-15-9-8-13(16)14(17)11-6-5-7-12(10-11)18(2,3)4/h5-7,10,13-17H,8-9H2,1-4H3 |
| InChIKey | NPESMJOKDIDWDB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|