C12H12O6 — CID 171877867
3,4-dihydroxy-4-(1-oxo-3H-2-benzofuran-5-yl)butanoic acid (PubChem CID 171877867) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(1-oxo-3H-2-benzofuran-5-yl)butanoic acid.
| Compound Name | 3,4-dihydroxy-4-(1-oxo-3H-2-benzofuran-5-yl)butanoic acid |
|---|---|
| PubChem CID | 171877867 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 3,4-dihydroxy-4-(1-oxo-3H-2-benzofuran-5-yl)butanoic acid |
| SMILES | O=C(O)CC(O)C(O)c1ccc2c(c1)COC2=O |
| InChI | InChI=1S/C12H12O6/c13-9(4-10(14)15)11(16)6-1-2-8-7(3-6)5-18-12(8)17/h1-3,9,11,13,16H,4-5H2,(H,14,15) |
| InChIKey | JZXOELAGJRMOPA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |