C12H14N2O4 — CID 171899410
3,4-dihydroxy-4-(1-oxo-2,3-dihydroisoindol-5-yl)butanamide (PubChem CID 171899410) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(1-oxo-2,3-dihydroisoindol-5-yl)butanamide.
| Compound Name | 3,4-dihydroxy-4-(1-oxo-2,3-dihydroisoindol-5-yl)butanamide |
|---|---|
| PubChem CID | 171899410 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3,4-dihydroxy-4-(1-oxo-2,3-dihydroisoindol-5-yl)butanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc2c(c1)CNC2=O |
| InChI | InChI=1S/C12H14N2O4/c13-10(16)4-9(15)11(17)6-1-2-8-7(3-6)5-14-12(8)18/h1-3,9,11,15,17H,4-5H2,(H2,13,16)(H,14,18) |
| InChIKey | TUJWFRMSWXPHDC-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |