C11H11N3O4 — CID 170826212
6-(3-azido-1,2-dihydroxypropyl)-3H-2-benzofuran-1-one (PubChem CID 170826212) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 6-(3-azido-1,2-dihydroxypropyl)-3H-2-benzofuran-1-one.
| Compound Name | 6-(3-azido-1,2-dihydroxypropyl)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 170826212 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 6-(3-azido-1,2-dihydroxypropyl)-3H-2-benzofuran-1-one |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1ccc2c(c1)C(=O)OC2 |
| InChI | InChI=1S/C11H11N3O4/c12-14-13-4-9(15)10(16)6-1-2-7-5-18-11(17)8(7)3-6/h1-3,9-10,15-16H,4-5H2 |
| InChIKey | CRNBEALBCIVYHJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|