C37H28N2O2 — CID 141279487
4-[3,6-bis(4-aminophenyl)-9-(4-hydroxyphenyl)fluoren-9-yl]phenol (PubChem CID 141279487) has the molecular formula C37H28N2O2 and a molecular weight of 532.64 g/mol. Its IUPAC name is 4-[3,6-bis(4-aminophenyl)-9-(4-hydroxyphenyl)fluoren-9-yl]phenol.
| Compound Name | 4-[3,6-bis(4-aminophenyl)-9-(4-hydroxyphenyl)fluoren-9-yl]phenol |
|---|---|
| PubChem CID | 141279487 |
| Molecular Formula | C37H28N2O2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 4-[3,6-bis(4-aminophenyl)-9-(4-hydroxyphenyl)fluoren-9-yl]phenol |
| SMILES | Nc1ccc(-c2ccc3c(c2)-c2cc(-c4ccc(N)cc4)ccc2C3(c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C37H28N2O2/c38-29-11-1-23(2-12-29)25-5-19-35-33(21-25)34-22-26(24-3-13-30(39)14-4-24)6-20-36(34)37(35,27-7-15-31(40)16-8-27)28-9-17-32(41)18-10-28/h1-22,40-41H,38-39H2 |
| InChIKey | RHWPTTUXMZCSJI-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|