[2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid

C27H23BO2 — CID 142721937

IUPAC[2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid
SMILESCC1(C)c2ccccc2-c2ccc(-c3ccccc3-c3ccccc3B(O)O)cc21
InChIInChI=1S/C27H23BO2/c1-27(2)24-13-7-5-11-21(24)22-16-15-18(17-25(22)27)19-9-3-4-10-20(19)23-12-6-8-14-26(23)28(29)30/h3-17,29-30H,1-2H3
InChIKeyOEDFQCOWGWLSJG-UHFFFAOYSA-N
MW390.29 g/mol
LogP5.01
Rot. Bonds3

About [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid

[2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid (PubChem CID 142721937) has the molecular formula C27H23BO2 and a molecular weight of 390.29 g/mol. Its IUPAC name is [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid.

Molecular Properties

Compound Name[2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid
PubChem CID142721937
Molecular FormulaC27H23BO2
Molecular Weight390.29 g/mol
Exact Mass390.18
IUPAC Name[2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid
SMILESCC1(C)c2ccccc2-c2ccc(-c3ccccc3-c3ccccc3B(O)O)cc21
InChIInChI=1S/C27H23BO2/c1-27(2)24-13-7-5-11-21(24)22-16-15-18(17-25(22)27)19-9-3-4-10-20(19)23-12-6-8-14-26(23)28(29)30/h3-17,29-30H,1-2H3
InChIKeyOEDFQCOWGWLSJG-UHFFFAOYSA-N
XLogP5.01
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms30
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500390.29
LogP ≤ 55.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid?
The IUPAC name of [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid (CID 142721937) is [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid.
What is the SMILES notation for [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid?
The canonical SMILES for [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid is CC1(C)c2ccccc2-c2ccc(-c3ccccc3-c3ccccc3B(O)O)cc21.
What is the InChIKey of [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid?
The InChIKey is OEDFQCOWGWLSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23BO2/c1-27(2)24-13-7-5-11-21(24)22-16-15-18(17-25(22)27)19-9-3-4-10-20(19)23-12-6-8-14-26(23)28(29)30/h3-17,29-30H,1-2H3.
What are the key properties of [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid?
[2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid has a molecular weight of 390.29 g/mol, XLogP of 5.01, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(9,9-dimethylfluoren-2-yl)phenyl]phenyl]boronic acid is sourced from PubChem (CID 142721937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).