C40H37NO4 — CID 58876588
2-[4-[4-(3,4-dimethyl-N-naphthalen-1-ylanilino)phenyl]-2-(2-prop-2-enoyloxyethyl)phenyl]ethyl prop-2-enoate (PubChem CID 58876588) has the molecular formula C40H37NO4 and a molecular weight of 595.74 g/mol. Its IUPAC name is 2-[4-[4-(3,4-dimethyl-N-naphthalen-1-ylanilino)phenyl]-2-(2-prop-2-enoyloxyethyl)phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[4-(3,4-dimethyl-N-naphthalen-1-ylanilino)phenyl]-2-(2-prop-2-enoyloxyethyl)phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 58876588 |
| Molecular Formula | C40H37NO4 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 2-[4-[4-(3,4-dimethyl-N-naphthalen-1-ylanilino)phenyl]-2-(2-prop-2-enoyloxyethyl)phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(-c2ccc(N(c3ccc(C)c(C)c3)c3cccc4ccccc34)cc2)cc1CCOC(=O)C=C |
| InChI | InChI=1S/C40H37NO4/c1-5-39(42)44-24-22-31-15-16-33(27-34(31)23-25-45-40(43)6-2)30-17-20-35(21-18-30)41(36-19-14-28(3)29(4)26-36)38-13-9-11-32-10-7-8-12-37(32)38/h5-21,26-27H,1-2,22-25H2,3-4H3 |
| InChIKey | PPEJJAQDAGABOA-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|