C22H26O3 — CID 134193261
[5-[4-(hydroxymethyl)phenyl]-2-propylphenyl]methyl (E)-2-methylbut-2-enoate (PubChem CID 134193261) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is [5-[4-(hydroxymethyl)phenyl]-2-propylphenyl]methyl (E)-2-methylbut-2-enoate.
| Compound Name | [5-[4-(hydroxymethyl)phenyl]-2-propylphenyl]methyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 134193261 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [5-[4-(hydroxymethyl)phenyl]-2-propylphenyl]methyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OCc1cc(-c2ccc(CO)cc2)ccc1CCC |
| InChI | InChI=1S/C22H26O3/c1-4-6-18-11-12-20(19-9-7-17(14-23)8-10-19)13-21(18)15-25-22(24)16(3)5-2/h5,7-13,23H,4,6,14-15H2,1-3H3/b16-5+ |
| InChIKey | OLVWSDIKJZOVAY-FZSIALSZSA-N |
| XLogP | 4.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|