C25H30O3 — CID 145122339
[5-[4-(hydroxymethyl)phenyl]-2-(4-methylcyclohexyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 145122339) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is [5-[4-(hydroxymethyl)phenyl]-2-(4-methylcyclohexyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-[4-(hydroxymethyl)phenyl]-2-(4-methylcyclohexyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122339 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | [5-[4-(hydroxymethyl)phenyl]-2-(4-methylcyclohexyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(CO)cc2)ccc1C1CCC(C)CC1 |
| InChI | InChI=1S/C25H30O3/c1-17(2)25(27)28-16-23-14-22(20-10-6-19(15-26)7-11-20)12-13-24(23)21-8-4-18(3)5-9-21/h6-7,10-14,18,21,26H,1,4-5,8-9,15-16H2,2-3H3 |
| InChIKey | JYKYGAQIWHVWHE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|