C27H28O5 — CID 134200743
2-[5-(2-hydroxyethoxy)-2-(2-methyl-4-phenylphenyl)phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134200743) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[5-(2-hydroxyethoxy)-2-(2-methyl-4-phenylphenyl)phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-(2-hydroxyethoxy)-2-(2-methyl-4-phenylphenyl)phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134200743 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 2-[5-(2-hydroxyethoxy)-2-(2-methyl-4-phenylphenyl)phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(OCCO)ccc1-c1ccc(-c2ccccc2)cc1C |
| InChI | InChI=1S/C27H28O5/c1-19(2)27(29)32-16-15-31-26-18-23(30-14-13-28)10-12-25(26)24-11-9-22(17-20(24)3)21-7-5-4-6-8-21/h4-12,17-18,28H,1,13-16H2,2-3H3 |
| InChIKey | NYMIPRYIFOWFHI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|