C34H43N3O10 — CID 171768265
4-O-[2-[4-[2-(benzotriazol-2-yl)-4-methylphenoxy]-4-oxobutanoyl]oxyethyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate (PubChem CID 171768265) has the molecular formula C34H43N3O10 and a molecular weight of 653.73 g/mol. Its IUPAC name is 4-O-[2-[4-[2-(benzotriazol-2-yl)-4-methylphenoxy]-4-oxobutanoyl]oxyethyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate.
| Compound Name | 4-O-[2-[4-[2-(benzotriazol-2-yl)-4-methylphenoxy]-4-oxobutanoyl]oxyethyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 171768265 |
| Molecular Formula | C34H43N3O10 |
| Molecular Weight | 653.73 g/mol |
| Exact Mass | 653.29 |
| IUPAC Name | 4-O-[2-[4-[2-(benzotriazol-2-yl)-4-methylphenoxy]-4-oxobutanoyl]oxyethyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate |
| SMILES | Cc1ccc(OC(=O)CCC(=O)OCCOC(=O)C(C)CC(C(=O)OC(C)C)C(C)C(=O)OC(C)C)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C34H43N3O10/c1-20(2)45-33(41)24(7)25(34(42)46-21(3)4)19-23(6)32(40)44-17-16-43-30(38)14-15-31(39)47-29-13-12-22(5)18-28(29)37-35-26-10-8-9-11-27(26)36-37/h8-13,18,20-21,23-25H,14-17,19H2,1-7H3 |
| InChIKey | QLELPIKPMVEWNR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 162.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.73 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|