C32H44O7 — CID 171768357
4-O-[5-(4-phenylphenoxy)pentyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate (PubChem CID 171768357) has the molecular formula C32H44O7 and a molecular weight of 540.70 g/mol. Its IUPAC name is 4-O-[5-(4-phenylphenoxy)pentyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate.
| Compound Name | 4-O-[5-(4-phenylphenoxy)pentyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 171768357 |
| Molecular Formula | C32H44O7 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 4-O-[5-(4-phenylphenoxy)pentyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate |
| SMILES | CC(C)OC(=O)C(C)C(CC(C)C(=O)OCCCCCOc1ccc(-c2ccccc2)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C32H44O7/c1-22(2)38-31(34)25(6)29(32(35)39-23(3)4)21-24(5)30(33)37-20-12-8-11-19-36-28-17-15-27(16-18-28)26-13-9-7-10-14-26/h7,9-10,13-18,22-25,29H,8,11-12,19-21H2,1-6H3 |
| InChIKey | SHIYYNRMUORQRH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|