C31H39NO7 — CID 171768337
4-O-[3-[4-(4-cyanophenyl)phenoxy]propyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate (PubChem CID 171768337) has the molecular formula C31H39NO7 and a molecular weight of 537.65 g/mol. Its IUPAC name is 4-O-[3-[4-(4-cyanophenyl)phenoxy]propyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate.
| Compound Name | 4-O-[3-[4-(4-cyanophenyl)phenoxy]propyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 171768337 |
| Molecular Formula | C31H39NO7 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 4-O-[3-[4-(4-cyanophenyl)phenoxy]propyl] 1-O,2-O-dipropan-2-yl 1-methylpentane-1,2,4-tricarboxylate |
| SMILES | CC(C)OC(=O)C(C)C(CC(C)C(=O)OCCCOc1ccc(-c2ccc(C#N)cc2)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C31H39NO7/c1-20(2)38-30(34)23(6)28(31(35)39-21(3)4)18-22(5)29(33)37-17-7-16-36-27-14-12-26(13-15-27)25-10-8-24(19-32)9-11-25/h8-15,20-23,28H,7,16-18H2,1-6H3 |
| InChIKey | GGWYDEVJJNZDON-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|