C27H38O5 — CID 155607341
[2-hydroxy-2-methyl-3-[6-(4-phenylphenoxy)hexoxy]propyl] 2-methylbutanoate (PubChem CID 155607341) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is [2-hydroxy-2-methyl-3-[6-(4-phenylphenoxy)hexoxy]propyl] 2-methylbutanoate.
| Compound Name | [2-hydroxy-2-methyl-3-[6-(4-phenylphenoxy)hexoxy]propyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 155607341 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | [2-hydroxy-2-methyl-3-[6-(4-phenylphenoxy)hexoxy]propyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC(C)(O)COCCCCCCOc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H38O5/c1-4-22(2)26(28)32-21-27(3,29)20-30-18-10-5-6-11-19-31-25-16-14-24(15-17-25)23-12-8-7-9-13-23/h7-9,12-17,22,29H,4-6,10-11,18-21H2,1-3H3 |
| InChIKey | VKYABYBSAKDMJS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|