C16H16N4O3 — CID 91962428
2-[2-(benzotriazol-2-yl)-4-methylphenoxy]-N-methoxyacetamide (PubChem CID 91962428) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-[2-(benzotriazol-2-yl)-4-methylphenoxy]-N-methoxyacetamide.
| Compound Name | 2-[2-(benzotriazol-2-yl)-4-methylphenoxy]-N-methoxyacetamide |
|---|---|
| PubChem CID | 91962428 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-[2-(benzotriazol-2-yl)-4-methylphenoxy]-N-methoxyacetamide |
| SMILES | CONC(=O)COc1ccc(C)cc1-n1nc2ccccc2n1 |
| InChI | InChI=1S/C16H16N4O3/c1-11-7-8-15(23-10-16(21)19-22-2)14(9-11)20-17-12-5-3-4-6-13(12)18-20/h3-9H,10H2,1-2H3,(H,19,21) |
| InChIKey | ZFBSKSQYZKUCHH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|