C24H24N4O4 — CID 24608824
2-[2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenoxy]-N-[(3-methoxyphenyl)methyl]acetamide (PubChem CID 24608824) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-[2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenoxy]-N-[(3-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenoxy]-N-[(3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 24608824 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-[2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenoxy]-N-[(3-methoxyphenyl)methyl]acetamide |
| SMILES | COc1cccc(CNC(=O)COc2ccc(CCO)cc2-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C24H24N4O4/c1-31-19-6-4-5-18(13-19)15-25-24(30)16-32-23-10-9-17(11-12-29)14-22(23)28-26-20-7-2-3-8-21(20)27-28/h2-10,13-14,29H,11-12,15-16H2,1H3,(H,25,30) |
| InChIKey | ADORTWHCYYVDOB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |