C22H26N4O3 — CID 18089217
2-[2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenoxy]-N-cyclohexylacetamide (PubChem CID 18089217) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenoxy]-N-cyclohexylacetamide.
| Compound Name | 2-[2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenoxy]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 18089217 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[2-(benzotriazol-2-yl)-4-(2-hydroxyethyl)phenoxy]-N-cyclohexylacetamide |
| SMILES | O=C(COc1ccc(CCO)cc1-n1nc2ccccc2n1)NC1CCCCC1 |
| InChI | InChI=1S/C22H26N4O3/c27-13-12-16-10-11-21(29-15-22(28)23-17-6-2-1-3-7-17)20(14-16)26-24-18-8-4-5-9-19(18)25-26/h4-5,8-11,14,17,27H,1-3,6-7,12-13,15H2,(H,23,28) |
| InChIKey | ZISUCNJTCGYJSR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |