C72H85N9O13 — CID 171768405
4-O,6-O,8-O-tris[4-[2-(benzotriazol-2-yl)-4-methylphenoxy]butyl] 1-O,2-O-dipropan-2-yl 1-methylnonane-1,2,4,6,8-pentacarboxylate (PubChem CID 171768405) has the molecular formula C72H85N9O13 and a molecular weight of 1284.52 g/mol. Its IUPAC name is 4-O,6-O,8-O-tris[4-[2-(benzotriazol-2-yl)-4-methylphenoxy]butyl] 1-O,2-O-dipropan-2-yl 1-methylnonane-1,2,4,6,8-pentacarboxylate.
| Compound Name | 4-O,6-O,8-O-tris[4-[2-(benzotriazol-2-yl)-4-methylphenoxy]butyl] 1-O,2-O-dipropan-2-yl 1-methylnonane-1,2,4,6,8-pentacarboxylate |
|---|---|
| PubChem CID | 171768405 |
| Molecular Formula | C72H85N9O13 |
| Molecular Weight | 1284.52 g/mol |
| Exact Mass | 1283.63 |
| IUPAC Name | 4-O,6-O,8-O-tris[4-[2-(benzotriazol-2-yl)-4-methylphenoxy]butyl] 1-O,2-O-dipropan-2-yl 1-methylnonane-1,2,4,6,8-pentacarboxylate |
| SMILES | Cc1ccc(OCCCCOC(=O)C(C)CC(CC(CC(C(=O)OC(C)C)C(C)C(=O)OC(C)C)C(=O)OCCCCOc2ccc(C)cc2-n2nc3ccccc3n2)C(=O)OCCCCOc2ccc(C)cc2-n2nc3ccccc3n2)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C72H85N9O13/c1-46(2)93-69(83)52(9)55(72(86)94-47(3)4)45-54(71(85)92-39-21-18-36-89-67-33-30-50(7)42-64(67)81-77-60-26-14-15-27-61(60)78-81)44-53(70(84)91-38-20-17-35-88-66-32-29-49(6)41-63(66)80-75-58-24-12-13-25-59(58)76-80)43-51(8)68(82)90-37-19-16-34-87-65-31-28-48(5)40-62(65)79-73-56-22-10-11-23-57(56)74-79/h10-15,22-33,40-42,46-47,51-55H,16-21,34-39,43-45H2,1-9H3 |
| InChIKey | SNTKGPIBKCGOIA-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 251.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 94 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1284.52 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|