C12H13Br — CID 101128597
1-bromo-4-[(1E)-hexa-1,5-dienyl]benzene (PubChem CID 101128597) has the molecular formula C12H13Br and a molecular weight of 237.14 g/mol. Its IUPAC name is 1-bromo-4-[(1E)-hexa-1,5-dienyl]benzene.
| Compound Name | 1-bromo-4-[(1E)-hexa-1,5-dienyl]benzene |
|---|---|
| PubChem CID | 101128597 |
| Molecular Formula | C12H13Br |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1-bromo-4-[(1E)-hexa-1,5-dienyl]benzene |
| SMILES | C=CCC/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13Br/c1-2-3-4-5-6-11-7-9-12(13)10-8-11/h2,5-10H,1,3-4H2/b6-5+ |
| InChIKey | BTKSQUYHXZSWAX-AATRIKPKSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|