C8H12N2O2 — CID 131031761
3-[(1S)-2-hydroxy-1-(methylamino)ethyl]-1H-pyridin-2-one (PubChem CID 131031761) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-[(1S)-2-hydroxy-1-(methylamino)ethyl]-1H-pyridin-2-one.
| Compound Name | 3-[(1S)-2-hydroxy-1-(methylamino)ethyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 131031761 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3-[(1S)-2-hydroxy-1-(methylamino)ethyl]-1H-pyridin-2-one |
| SMILES | CN[C@H](CO)c1ccc[nH]c1=O |
| InChI | InChI=1S/C8H12N2O2/c1-9-7(5-11)6-3-2-4-10-8(6)12/h2-4,7,9,11H,5H2,1H3,(H,10,12)/t7-/m1/s1 |
| InChIKey | JCGCKUVIVHGLHV-SSDOTTSWSA-N |
| XLogP | -0.37 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |