C7H11N3O — CID 55275457
3-[(1S)-1,2-diaminoethyl]-1H-pyridin-2-one (PubChem CID 55275457) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 3-[(1S)-1,2-diaminoethyl]-1H-pyridin-2-one.
| Compound Name | 3-[(1S)-1,2-diaminoethyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 55275457 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 3-[(1S)-1,2-diaminoethyl]-1H-pyridin-2-one |
| SMILES | NC[C@@H](N)c1ccc[nH]c1=O |
| InChI | InChI=1S/C7H11N3O/c8-4-6(9)5-2-1-3-10-7(5)11/h1-3,6H,4,8-9H2,(H,10,11)/t6-/m1/s1 |
| InChIKey | CUAPNNINABPKKO-ZCFIWIBFSA-N |
| XLogP | -0.67 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |